C24H17ClF6N6O2 — CID 161309463
2-chloro-6-[2-(trifluoromethyl)phenyl]pyridine-3,4-diamine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 161309463) has the molecular formula C24H17ClF6N6O2 and a molecular weight of 570.88 g/mol. Its IUPAC name is 2-chloro-6-[2-(trifluoromethyl)phenyl]pyridine-3,4-diamine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | 2-chloro-6-[2-(trifluoromethyl)phenyl]pyridine-3,4-diamine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 161309463 |
| Molecular Formula | C24H17ClF6N6O2 |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 2-chloro-6-[2-(trifluoromethyl)phenyl]pyridine-3,4-diamine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | Nc1cc(-c2ccccc2C(F)(F)F)nc(Cl)c1N.Nc1cc(-c2ccccc2C(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9ClF3N3.C12H8F3N3O2/c13-11-10(18)8(17)5-9(19-11)6-3-1-2-4-7(6)12(14,15)16;13-12(14,15)8-4-2-1-3-7(8)10-5-9(16)11(6-17-10)18(19)20/h1-5H,18H2,(H2,17,19);1-6H,(H2,16,17) |
| InChIKey | VIRPRCKGMWSJGD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|