About 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane
3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane (PubChem CID 161313715) has the molecular formula C17H44O8
and a molecular weight of 376.53 g/mol. Its IUPAC name is 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane.
Molecular Properties
| Compound Name | 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane |
| PubChem CID | 161313715 |
| Molecular Formula | C17H44O8 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane |
| SMILES | C.C.C.C.C.C.C.C.COC(=O)CC(=O)OCOC(=O)CCOC=O |
| InChI | InChI=1S/C9H12O8.8CH4/c1-14-8(12)4-9(13)17-6-16-7(11)2-3-15-5-10;;;;;;;;/h5H,2-4,6H2,1H3;8*1H4 |
| InChIKey | VJFNVFWIZGZQHM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane?
The IUPAC name of 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane (CID 161313715) is 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane.
What is the SMILES notation for 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane?
The canonical SMILES for 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane is C.C.C.C.C.C.C.C.COC(=O)CC(=O)OCOC(=O)CCOC=O.
What is the InChIKey of 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane?
The InChIKey is VJFNVFWIZGZQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O8.8CH4/c1-14-8(12)4-9(13)17-6-16-7(11)2-3-15-5-10;;;;;;;;/h5H,2-4,6H2,1H3;8*1H4.
What are the key properties of 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane?
3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane has a molecular weight of 376.53 g/mol, XLogP of 4.25, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(3-formyloxypropanoyloxymethyl) 1-O-methyl propanedioate;methane is sourced from PubChem (CID 161313715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).