C8H14N2O6 — CID 57194355
methyl 3-[2-(2-aminooxyacetyl)oxyethenylamino]oxypropanoate (PubChem CID 57194355) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is methyl 3-[2-(2-aminooxyacetyl)oxyethenylamino]oxypropanoate.
| Compound Name | methyl 3-[2-(2-aminooxyacetyl)oxyethenylamino]oxypropanoate |
|---|---|
| PubChem CID | 57194355 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | methyl 3-[2-(2-aminooxyacetyl)oxyethenylamino]oxypropanoate |
| SMILES | COC(=O)CCONC=COC(=O)CON |
| InChI | InChI=1S/C8H14N2O6/c1-13-7(11)2-4-16-10-3-5-14-8(12)6-15-9/h3,5,10H,2,4,6,9H2,1H3 |
| InChIKey | RSFSSWNKBLNLSH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|