About trisodium;3-O-formyl 1-O-methyl propanedioate;hydride
trisodium;3-O-formyl 1-O-methyl propanedioate;hydride (PubChem CID 173454112) has the molecular formula C5H9Na3O5
and a molecular weight of 218.09 g/mol. Its IUPAC name is trisodium;3-O-formyl 1-O-methyl propanedioate;hydride.
Molecular Properties
| Compound Name | trisodium;3-O-formyl 1-O-methyl propanedioate;hydride |
| PubChem CID | 173454112 |
| Molecular Formula | C5H9Na3O5 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | trisodium;3-O-formyl 1-O-methyl propanedioate;hydride |
| SMILES | COC(=O)CC(=O)OC=O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C5H6O5.3Na.3H/c1-9-4(7)2-5(8)10-3-6;;;;;;/h3H,2H2,1H3;;;;;;/q;3*+1;3*-1 |
| InChIKey | KQKHSGXPBJOAFL-UHFFFAOYSA-N |
| XLogP | -9.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | -9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze trisodium;3-O-formyl 1-O-methyl propanedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;3-O-formyl 1-O-methyl propanedioate;hydride?
The IUPAC name of trisodium;3-O-formyl 1-O-methyl propanedioate;hydride (CID 173454112) is trisodium;3-O-formyl 1-O-methyl propanedioate;hydride.
What is the SMILES notation for trisodium;3-O-formyl 1-O-methyl propanedioate;hydride?
The canonical SMILES for trisodium;3-O-formyl 1-O-methyl propanedioate;hydride is COC(=O)CC(=O)OC=O.[H-].[H-].[H-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;3-O-formyl 1-O-methyl propanedioate;hydride?
The InChIKey is KQKHSGXPBJOAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O5.3Na.3H/c1-9-4(7)2-5(8)10-3-6;;;;;;/h3H,2H2,1H3;;;;;;/q;3*+1;3*-1.
What are the key properties of trisodium;3-O-formyl 1-O-methyl propanedioate;hydride?
trisodium;3-O-formyl 1-O-methyl propanedioate;hydride has a molecular weight of 218.09 g/mol, XLogP of -9.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;3-O-formyl 1-O-methyl propanedioate;hydride is sourced from PubChem (CID 173454112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).