C65H78N2O6 — CID 161319819
4-(2-benzyl-1-phenylbut-1-enyl)-N-[3-(oxan-2-yloxy)propyl]aniline;ethyl N-[4-(2-benzyl-1-phenylbut-1-enyl)phenyl]-N-[3-(oxan-2-yloxy)propyl]carbamate (PubChem CID 161319819) has the molecular formula C65H78N2O6 and a molecular weight of 983.35 g/mol. Its IUPAC name is 4-(2-benzyl-1-phenylbut-1-enyl)-N-[3-(oxan-2-yloxy)propyl]aniline;ethyl N-[4-(2-benzyl-1-phenylbut-1-enyl)phenyl]-N-[3-(oxan-2-yloxy)propyl]carbamate.
| Compound Name | 4-(2-benzyl-1-phenylbut-1-enyl)-N-[3-(oxan-2-yloxy)propyl]aniline;ethyl N-[4-(2-benzyl-1-phenylbut-1-enyl)phenyl]-N-[3-(oxan-2-yloxy)propyl]carbamate |
|---|---|
| PubChem CID | 161319819 |
| Molecular Formula | C65H78N2O6 |
| Molecular Weight | 983.35 g/mol |
| Exact Mass | 982.59 |
| IUPAC Name | 4-(2-benzyl-1-phenylbut-1-enyl)-N-[3-(oxan-2-yloxy)propyl]aniline;ethyl N-[4-(2-benzyl-1-phenylbut-1-enyl)phenyl]-N-[3-(oxan-2-yloxy)propyl]carbamate |
| SMILES | CCC(Cc1ccccc1)=C(c1ccccc1)c1ccc(NCCCOC2CCCCO2)cc1.CCOC(=O)N(CCCOC1CCCCO1)c1ccc(C(=C(CC)Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H41NO4.C31H37NO2/c1-3-28(26-27-14-7-5-8-15-27)33(29-16-9-6-10-17-29)30-19-21-31(22-20-30)35(34(36)37-4-2)23-13-25-39-32-18-11-12-24-38-32;1-2-26(24-25-12-5-3-6-13-25)31(27-14-7-4-8-15-27)28-17-19-29(20-18-28)32-21-11-23-34-30-16-9-10-22-33-30/h5-10,14-17,19-22,32H,3-4,11-13,18,23-26H2,1-2H3;3-8,12-15,17-20,30,32H,2,9-11,16,21-24H2,1H3 |
| InChIKey | VJZJHPZGOASVFB-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.35 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|