C16H19F2N3O3 — CID 87361368
3-cyano-1-(3,4-difluorophenyl)-1-[3-(oxan-2-yloxy)propyl]urea (PubChem CID 87361368) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 3-cyano-1-(3,4-difluorophenyl)-1-[3-(oxan-2-yloxy)propyl]urea.
| Compound Name | 3-cyano-1-(3,4-difluorophenyl)-1-[3-(oxan-2-yloxy)propyl]urea |
|---|---|
| PubChem CID | 87361368 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-cyano-1-(3,4-difluorophenyl)-1-[3-(oxan-2-yloxy)propyl]urea |
| SMILES | N#CNC(=O)N(CCCOC1CCCCO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H19F2N3O3/c17-13-6-5-12(10-14(13)18)21(16(22)20-11-19)7-3-9-24-15-4-1-2-8-23-15/h5-6,10,15H,1-4,7-9H2,(H,20,22) |
| InChIKey | ZNAJLDAAQYSBEO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|