C22H31N8O16P4-3 — CID 161324231
[[(2S,5S)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [2-[4-[4-[but-2-ynoxy(hydroxy)phosphoryl]oxybutyl]triazol-1-yl]ethoxy-oxidophosphoryl] phosphate (PubChem CID 161324231) has the molecular formula C22H31N8O16P4-3 and a molecular weight of 787.43 g/mol. Its IUPAC name is [[(2S,5S)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [2-[4-[4-[but-2-ynoxy(hydroxy)phosphoryl]oxybutyl]triazol-1-yl]ethoxy-oxidophosphoryl] phosphate.
| Compound Name | [[(2S,5S)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [2-[4-[4-[but-2-ynoxy(hydroxy)phosphoryl]oxybutyl]triazol-1-yl]ethoxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 161324231 |
| Molecular Formula | C22H31N8O16P4-3 |
| Molecular Weight | 787.43 g/mol |
| Exact Mass | 787.08 |
| IUPAC Name | [[(2S,5S)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [2-[4-[4-[but-2-ynoxy(hydroxy)phosphoryl]oxybutyl]triazol-1-yl]ethoxy-oxidophosphoryl] phosphate |
| SMILES | CC#CCOP(=O)(O)OCCCCc1cn(CCOP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OC[C@@H]2O[C@H](n3cnc4c(N)ncnc43)CC2O)nn1 |
| InChI | InChI=1S/C22H34N8O16P4/c1-2-3-8-40-47(32,33)41-9-5-4-6-16-12-29(28-27-16)7-10-42-48(34,35)45-50(38,39)46-49(36,37)43-13-18-17(31)11-19(44-18)30-15-26-20-21(23)24-14-25-22(20)30/h12,14-15,17-19,31H,4-11,13H2,1H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39)(H2,23,24,25)/p-3/t17?,18-,19-/m0/s1 |
| InChIKey | VKOBDKUAUGKHIB-MNNMKWMVSA-K |
| XLogP | -0.70 |
| TPSA | 342.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.43 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|