About 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide
2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide (PubChem CID 161325967) has the molecular formula C22H40Cl2INO2S2
and a molecular weight of 612.51 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide.
Molecular Properties
| Compound Name | 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide |
| PubChem CID | 161325967 |
| Molecular Formula | C22H40Cl2INO2S2 |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(Cl)C=Cc1ccc(Cl)s1.[I-] |
| InChI | InChI=1S/C16H36N.C6H4Cl2O2S2.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-6-2-1-5(11-6)3-4-12(8,9)10;/h5-16H2,1-4H3;1-4H;1H/q+1;;/p-1 |
| InChIKey | DYHQZJMSBPGKFC-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide?
The IUPAC name of 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide (CID 161325967) is 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide.
What is the SMILES notation for 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide?
The canonical SMILES for 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(Cl)C=Cc1ccc(Cl)s1.[I-].
What is the InChIKey of 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide?
The InChIKey is DYHQZJMSBPGKFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C6H4Cl2O2S2.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-6-2-1-5(11-6)3-4-12(8,9)10;/h5-16H2,1-4H3;1-4H;1H/q+1;;/p-1.
What are the key properties of 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide?
2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide has a molecular weight of 612.51 g/mol, XLogP of 4.95, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chlorothiophen-2-yl)ethenesulfonyl chloride;tetrabutylazanium;iodide is sourced from PubChem (CID 161325967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).