C22H44O6Si3 — CID 161327572
ethane;methane;methyl 2-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-oxoacetate (PubChem CID 161327572) has the molecular formula C22H44O6Si3 and a molecular weight of 488.85 g/mol. Its IUPAC name is ethane;methane;methyl 2-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-oxoacetate.
| Compound Name | ethane;methane;methyl 2-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 161327572 |
| Molecular Formula | C22H44O6Si3 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | ethane;methane;methyl 2-[4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-oxoacetate |
| SMILES | C.CC.COC(=O)C(=O)c1ccc(OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H34O6Si3.C2H6.CH4/c1-22-19(21)18(20)16-10-12-17(13-11-16)23-14-9-15-28(8,24-26(2,3)4)25-27(5,6)7;1-2;/h10-13H,9,14-15H2,1-8H3;1-2H3;1H4 |
| InChIKey | VKYXJAOTAFOCHF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|