C42H46N2 — CID 161333393
3,5,7-trimethyl-2-(2,4,5-trimethylphenyl)quinoline;3,5,7-trimethyl-2-(3,4,5-trimethylphenyl)quinoline (PubChem CID 161333393) has the molecular formula C42H46N2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 3,5,7-trimethyl-2-(2,4,5-trimethylphenyl)quinoline;3,5,7-trimethyl-2-(3,4,5-trimethylphenyl)quinoline.
| Compound Name | 3,5,7-trimethyl-2-(2,4,5-trimethylphenyl)quinoline;3,5,7-trimethyl-2-(3,4,5-trimethylphenyl)quinoline |
|---|---|
| PubChem CID | 161333393 |
| Molecular Formula | C42H46N2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 3,5,7-trimethyl-2-(2,4,5-trimethylphenyl)quinoline;3,5,7-trimethyl-2-(3,4,5-trimethylphenyl)quinoline |
| SMILES | Cc1cc(C)c2cc(C)c(-c3cc(C)c(C)c(C)c3)nc2c1.Cc1cc(C)c2cc(C)c(-c3cc(C)c(C)cc3C)nc2c1 |
| InChI | InChI=1S/2C21H23N/c1-12-7-15(4)19-11-16(5)21(22-20(19)8-12)18-9-13(2)17(6)14(3)10-18;1-12-7-15(4)18-11-17(6)21(22-20(18)8-12)19-10-14(3)13(2)9-16(19)5/h2*7-11H,1-6H3 |
| InChIKey | VLSFGAKJPPMLNT-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |