About (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid
(5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid (PubChem CID 161336387) has the molecular formula C20H38O6
and a molecular weight of 374.52 g/mol. Its IUPAC name is (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid.
Molecular Properties
| Compound Name | (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid |
| PubChem CID | 161336387 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid |
| SMILES | CCCC(=O)C[C@@H](CCC)C(=O)O.CCCC(=O)[C@@H](CCC)COCO |
| InChI | InChI=1S/C10H20O3.C10H18O3/c1-3-5-9(7-13-8-11)10(12)6-4-2;1-3-5-8(10(12)13)7-9(11)6-4-2/h9,11H,3-8H2,1-2H3;8H,3-7H2,1-2H3,(H,12,13)/t9-;8-/m01/s1 |
| InChIKey | VMBZUDVOKGPHJL-CRKQZGGQSA-N |
| XLogP | 3.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid?
The IUPAC name of (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid (CID 161336387) is (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid.
What is the SMILES notation for (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid?
The canonical SMILES for (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid is CCCC(=O)C[C@@H](CCC)C(=O)O.CCCC(=O)[C@@H](CCC)COCO.
What is the InChIKey of (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid?
The InChIKey is VMBZUDVOKGPHJL-CRKQZGGQSA-N. The full InChI is InChI=1S/C10H20O3.C10H18O3/c1-3-5-9(7-13-8-11)10(12)6-4-2;1-3-5-8(10(12)13)7-9(11)6-4-2/h9,11H,3-8H2,1-2H3;8H,3-7H2,1-2H3,(H,12,13)/t9-;8-/m01/s1.
What are the key properties of (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid?
(5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid has a molecular weight of 374.52 g/mol, XLogP of 3.98, 15 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(hydroxymethoxymethyl)octan-4-one;(2R)-4-oxo-2-propylheptanoic acid is sourced from PubChem (CID 161336387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).