C35H50BrNO — CID 161337308
2-(2-bromoethyl)benzaldehyde;1-cyclohexylethanamine;3-(1-cyclohexylethyl)-1,2-dihydronaphthalene (PubChem CID 161337308) has the molecular formula C35H50BrNO and a molecular weight of 580.70 g/mol. Its IUPAC name is 2-(2-bromoethyl)benzaldehyde;1-cyclohexylethanamine;3-(1-cyclohexylethyl)-1,2-dihydronaphthalene.
| Compound Name | 2-(2-bromoethyl)benzaldehyde;1-cyclohexylethanamine;3-(1-cyclohexylethyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 161337308 |
| Molecular Formula | C35H50BrNO |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 2-(2-bromoethyl)benzaldehyde;1-cyclohexylethanamine;3-(1-cyclohexylethyl)-1,2-dihydronaphthalene |
| SMILES | CC(C1=Cc2ccccc2CC1)C1CCCCC1.CC(N)C1CCCCC1.O=Cc1ccccc1CCBr |
| InChI | InChI=1S/C18H24.C9H9BrO.C8H17N/c1-14(15-7-3-2-4-8-15)17-12-11-16-9-5-6-10-18(16)13-17;10-6-5-8-3-1-2-4-9(8)7-11;1-7(9)8-5-3-2-4-6-8/h5-6,9-10,13-15H,2-4,7-8,11-12H2,1H3;1-4,7H,5-6H2;7-8H,2-6,9H2,1H3 |
| InChIKey | VMEZGTCYSZTKBS-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|