C34H41N3O9 — CID 161340860
(2R,5S)-2-benzyl-N-[(2R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-5-[[2-(5-methyl-2,4-dioxo-1-pyridinyl)acetyl]amino]-4-oxo-6-phenylhexanamide (PubChem CID 161340860) has the molecular formula C34H41N3O9 and a molecular weight of 635.71 g/mol. Its IUPAC name is (2R,5S)-2-benzyl-N-[(2R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-5-[[2-(5-methyl-2,4-dioxo-1-pyridinyl)acetyl]amino]-4-oxo-6-phenylhexanamide.
| Compound Name | (2R,5S)-2-benzyl-N-[(2R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-5-[[2-(5-methyl-2,4-dioxo-1-pyridinyl)acetyl]amino]-4-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 161340860 |
| Molecular Formula | C34H41N3O9 |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | (2R,5S)-2-benzyl-N-[(2R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-5-[[2-(5-methyl-2,4-dioxo-1-pyridinyl)acetyl]amino]-4-oxo-6-phenylhexanamide |
| SMILES | CC[C@H]1O[C@@H](O)C(NC(=O)[C@@H](CC(=O)[C@H](Cc2ccccc2)NC(=O)CN2C=C(C)C(=O)CC2=O)Cc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H41N3O9/c1-3-27-31(42)32(43)30(34(45)46-27)36-33(44)23(14-21-10-6-4-7-11-21)16-26(39)24(15-22-12-8-5-9-13-22)35-28(40)19-37-18-20(2)25(38)17-29(37)41/h4-13,18,23-24,27,30-32,34,42-43,45H,3,14-17,19H2,1-2H3,(H,35,40)(H,36,44)/t23-,24+,27-,30?,31-,32-,34-/m1/s1 |
| InChIKey | FFNNDHJOZWBXLI-LYYBHUGGSA-N |
| XLogP | 0.57 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|