About 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid
5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid (PubChem CID 161343548) has the molecular formula C21H20Cl2N2O2
and a molecular weight of 403.31 g/mol. Its IUPAC name is 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid |
| PubChem CID | 161343548 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid |
| SMILES | Cc1cc2cc(Cl)ccc2[nH]1.Cc1cc2cc(Cl)ccc2n1C(C)C(=O)O |
| InChI | InChI=1S/C12H12ClNO2.C9H8ClN/c1-7-5-9-6-10(13)3-4-11(9)14(7)8(2)12(15)16;1-6-4-7-5-8(10)2-3-9(7)11-6/h3-6,8H,1-2H3,(H,15,16);2-5,11H,1H3 |
| InChIKey | VMZOWKHYNLXQCW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid?
The IUPAC name of 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid (CID 161343548) is 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid.
What is the SMILES notation for 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid?
The canonical SMILES for 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid is Cc1cc2cc(Cl)ccc2[nH]1.Cc1cc2cc(Cl)ccc2n1C(C)C(=O)O.
What is the InChIKey of 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid?
The InChIKey is VMZOWKHYNLXQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2.C9H8ClN/c1-7-5-9-6-10(13)3-4-11(9)14(7)8(2)12(15)16;1-6-4-7-5-8(10)2-3-9(7)11-6/h3-6,8H,1-2H3,(H,15,16);2-5,11H,1H3.
What are the key properties of 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid?
5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid has a molecular weight of 403.31 g/mol, XLogP of 6.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-1H-indole;2-(5-chloro-2-methylindol-1-yl)propanoic acid is sourced from PubChem (CID 161343548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).