C15H27N3O7S — CID 161349871
(2S)-2-aminobutan-1-ol;N-(2-hydroxyethyl)-N-(3-hydroxypropyl)-2-nitrobenzenesulfonamide (PubChem CID 161349871) has the molecular formula C15H27N3O7S and a molecular weight of 393.46 g/mol. Its IUPAC name is (2S)-2-aminobutan-1-ol;N-(2-hydroxyethyl)-N-(3-hydroxypropyl)-2-nitrobenzenesulfonamide.
| Compound Name | (2S)-2-aminobutan-1-ol;N-(2-hydroxyethyl)-N-(3-hydroxypropyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 161349871 |
| Molecular Formula | C15H27N3O7S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2S)-2-aminobutan-1-ol;N-(2-hydroxyethyl)-N-(3-hydroxypropyl)-2-nitrobenzenesulfonamide |
| SMILES | CC[C@H](N)CO.O=[N+]([O-])c1ccccc1S(=O)(=O)N(CCO)CCCO |
| InChI | InChI=1S/C11H16N2O6S.C4H11NO/c14-8-3-6-12(7-9-15)20(18,19)11-5-2-1-4-10(11)13(16)17;1-2-4(5)3-6/h1-2,4-5,14-15H,3,6-9H2;4,6H,2-3,5H2,1H3/t;4-/m.0/s1 |
| InChIKey | VNUFAWUNSFZCFF-VWMHFEHESA-N |
| XLogP | -0.32 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|