C13H21ClN4O6S — CID 70413453
2-[2-(dimethylamino)ethyl-(2-hydroxyethyl)sulfamoyl]-6-nitrobenzamide;hydrochloride (PubChem CID 70413453) has the molecular formula C13H21ClN4O6S and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(2-hydroxyethyl)sulfamoyl]-6-nitrobenzamide;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethyl-(2-hydroxyethyl)sulfamoyl]-6-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 70413453 |
| Molecular Formula | C13H21ClN4O6S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(2-hydroxyethyl)sulfamoyl]-6-nitrobenzamide;hydrochloride |
| SMILES | CN(C)CCN(CCO)S(=O)(=O)c1cccc([N+](=O)[O-])c1C(N)=O.Cl |
| InChI | InChI=1S/C13H20N4O6S.ClH/c1-15(2)6-7-16(8-9-18)24(22,23)11-5-3-4-10(17(20)21)12(11)13(14)19;/h3-5,18H,6-9H2,1-2H3,(H2,14,19);1H |
| InChIKey | OJTUGGHCAJDHSC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 147.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|