C11H15NO6S — CID 102590988
(2R)-2-(2-nitrophenyl)sulfonylpentane-1,5-diol (PubChem CID 102590988) has the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. Its IUPAC name is (2R)-2-(2-nitrophenyl)sulfonylpentane-1,5-diol.
| Compound Name | (2R)-2-(2-nitrophenyl)sulfonylpentane-1,5-diol |
|---|---|
| PubChem CID | 102590988 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (2R)-2-(2-nitrophenyl)sulfonylpentane-1,5-diol |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)[C@@H](CO)CCCO |
| InChI | InChI=1S/C11H15NO6S/c13-7-3-4-9(8-14)19(17,18)11-6-2-1-5-10(11)12(15)16/h1-2,5-6,9,13-14H,3-4,7-8H2/t9-/m1/s1 |
| InChIKey | JVAGNTBRHUXSKX-SECBINFHSA-N |
| XLogP | 0.50 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|