C16H21BrN2S2Si2 — CID 161350387
2-(5-bromo-1,3-thiazol-2-yl)ethynyl-trimethylsilane;trimethyl-[2-(1,3-thiazol-2-yl)ethynyl]silane (PubChem CID 161350387) has the molecular formula C16H21BrN2S2Si2 and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-(5-bromo-1,3-thiazol-2-yl)ethynyl-trimethylsilane;trimethyl-[2-(1,3-thiazol-2-yl)ethynyl]silane.
| Compound Name | 2-(5-bromo-1,3-thiazol-2-yl)ethynyl-trimethylsilane;trimethyl-[2-(1,3-thiazol-2-yl)ethynyl]silane |
|---|---|
| PubChem CID | 161350387 |
| Molecular Formula | C16H21BrN2S2Si2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | 2-(5-bromo-1,3-thiazol-2-yl)ethynyl-trimethylsilane;trimethyl-[2-(1,3-thiazol-2-yl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ncc(Br)s1.C[Si](C)(C)C#Cc1nccs1 |
| InChI | InChI=1S/C8H10BrNSSi.C8H11NSSi/c1-12(2,3)5-4-8-10-6-7(9)11-8;1-11(2,3)7-4-8-9-5-6-10-8/h6H,1-3H3;5-6H,1-3H3 |
| InChIKey | VNVVTBZTVDWUAZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|