C13H15BrN2O2S2Si — CID 68599008
1-(5-bromo-1,3-thiazol-4-yl)-2-[5-(2-trimethylsilylethynyl)-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 68599008) has the molecular formula C13H15BrN2O2S2Si and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-4-yl)-2-[5-(2-trimethylsilylethynyl)-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-(5-bromo-1,3-thiazol-4-yl)-2-[5-(2-trimethylsilylethynyl)-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 68599008 |
| Molecular Formula | C13H15BrN2O2S2Si |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-4-yl)-2-[5-(2-trimethylsilylethynyl)-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | C[Si](C)(C)C#Cc1scnc1C(O)C(O)c1ncsc1Br |
| InChI | InChI=1S/C13H15BrN2O2S2Si/c1-21(2,3)5-4-8-9(15-6-19-8)11(17)12(18)10-13(14)20-7-16-10/h6-7,11-12,17-18H,1-3H3 |
| InChIKey | ABGRTYXPCLETRK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|