C7H4BrNOS — CID 164654545
1-(5-bromo-1,3-thiazol-4-yl)but-3-yn-1-one (PubChem CID 164654545) has the molecular formula C7H4BrNOS and a molecular weight of 230.09 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-4-yl)but-3-yn-1-one.
| Compound Name | 1-(5-bromo-1,3-thiazol-4-yl)but-3-yn-1-one |
|---|---|
| PubChem CID | 164654545 |
| Molecular Formula | C7H4BrNOS |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 228.92 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-4-yl)but-3-yn-1-one |
| SMILES | C#CCC(=O)c1ncsc1Br |
| InChI | InChI=1S/C7H4BrNOS/c1-2-3-5(10)6-7(8)11-4-9-6/h1,4H,3H2 |
| InChIKey | GKCQLPPXHLZSIW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|