C19H22N4O7S2 — CID 161351914
[(2R,3R,5S)-2-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate;1-hydroperoxysulfanyl-4-methylbenzene (PubChem CID 161351914) has the molecular formula C19H22N4O7S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is [(2R,3R,5S)-2-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate;1-hydroperoxysulfanyl-4-methylbenzene.
| Compound Name | [(2R,3R,5S)-2-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate;1-hydroperoxysulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 161351914 |
| Molecular Formula | C19H22N4O7S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | [(2R,3R,5S)-2-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate;1-hydroperoxysulfanyl-4-methylbenzene |
| SMILES | CC(=O)O[C@@H]1C[C@@H](CO)O[C@H]1n1c(=O)sc2cnc(N)nc21.Cc1ccc(SOO)cc1 |
| InChI | InChI=1S/C12H14N4O5S.C7H8O2S/c1-5(18)20-7-2-6(4-17)21-10(7)16-9-8(22-12(16)19)3-14-11(13)15-9;1-6-2-4-7(5-3-6)10-9-8/h3,6-7,10,17H,2,4H2,1H3,(H2,13,14,15);2-5,8H,1H3/t6-,7+,10+;/m0./s1 |
| InChIKey | VOANZXLSEOTCCL-LVJSCHTASA-N |
| XLogP | 2.14 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|