C16H21ClN4O2 — CID 161356736
tert-butyl 4-(6-chloro-3H-pyrrolo[2,3-b]pyridin-2-yl)piperazine-1-carboxylate (PubChem CID 161356736) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is tert-butyl 4-(6-chloro-3H-pyrrolo[2,3-b]pyridin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-chloro-3H-pyrrolo[2,3-b]pyridin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 161356736 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | tert-butyl 4-(6-chloro-3H-pyrrolo[2,3-b]pyridin-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2=Nc3nc(Cl)ccc3C2)CC1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-16(2,3)23-15(22)21-8-6-20(7-9-21)13-10-11-4-5-12(17)18-14(11)19-13/h4-5H,6-10H2,1-3H3 |
| InChIKey | YADCFDIKEMMSRY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|