C14H15ClN2O3S — CID 161357249
2-(benzenesulfonyl)-1-(5-chloro-1-propylimidazol-4-yl)ethanone (PubChem CID 161357249) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(5-chloro-1-propylimidazol-4-yl)ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-(5-chloro-1-propylimidazol-4-yl)ethanone |
|---|---|
| PubChem CID | 161357249 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(5-chloro-1-propylimidazol-4-yl)ethanone |
| SMILES | CCCn1cnc(C(=O)CS(=O)(=O)c2ccccc2)c1Cl |
| InChI | InChI=1S/C14H15ClN2O3S/c1-2-8-17-10-16-13(14(17)15)12(18)9-21(19,20)11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | VORXTWLQBXDIEM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |