About carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate
carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate (PubChem CID 161360607) has the molecular formula C8H18O6S4
and a molecular weight of 338.49 g/mol. Its IUPAC name is carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate.
Molecular Properties
| Compound Name | carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate |
| PubChem CID | 161360607 |
| Molecular Formula | C8H18O6S4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCSSCCCS(=O)(=O)[O-].[CH3+].[CH3+] |
| InChI | InChI=1S/C6H14O6S4.2CH3/c7-15(8,9)5-1-3-13-14-4-2-6-16(10,11)12;;/h1-6H2,(H,7,8,9)(H,10,11,12);2*1H3/q;2*+1/p-2 |
| InChIKey | VPCUDJYDGWGLLR-UHFFFAOYSA-L |
| XLogP | 1.14 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate?
The IUPAC name of carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate (CID 161360607) is carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate.
What is the SMILES notation for carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate?
The canonical SMILES for carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate is O=S(=O)([O-])CCCSSCCCS(=O)(=O)[O-].[CH3+].[CH3+].
What is the InChIKey of carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate?
The InChIKey is VPCUDJYDGWGLLR-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14O6S4.2CH3/c7-15(8,9)5-1-3-13-14-4-2-6-16(10,11)12;;/h1-6H2,(H,7,8,9)(H,10,11,12);2*1H3/q;2*+1/p-2.
What are the key properties of carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate?
carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate has a molecular weight of 338.49 g/mol, XLogP of 1.14, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;3-(3-sulfonatopropyldisulfanyl)propane-1-sulfonate is sourced from PubChem (CID 161360607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).