C19H26BN3O6S — CID 161361717
4-ethyl-N-[(2S)-4-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-oxobutan-2-yl]-2,3-dioxopiperazine-1-sulfinamide (PubChem CID 161361717) has the molecular formula C19H26BN3O6S and a molecular weight of 435.31 g/mol. Its IUPAC name is 4-ethyl-N-[(2S)-4-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-oxobutan-2-yl]-2,3-dioxopiperazine-1-sulfinamide.
| Compound Name | 4-ethyl-N-[(2S)-4-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-oxobutan-2-yl]-2,3-dioxopiperazine-1-sulfinamide |
|---|---|
| PubChem CID | 161361717 |
| Molecular Formula | C19H26BN3O6S |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-ethyl-N-[(2S)-4-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-oxobutan-2-yl]-2,3-dioxopiperazine-1-sulfinamide |
| SMILES | CCN1CCN(S(=O)N[C@@H](C)C(=O)C[C@H]2Cc3cccc(C)c3OB2O)C(=O)C1=O |
| InChI | InChI=1S/C19H26BN3O6S/c1-4-22-8-9-23(19(26)18(22)25)30(28)21-13(3)16(24)11-15-10-14-7-5-6-12(2)17(14)29-20(15)27/h5-7,13,15,21,27H,4,8-11H2,1-3H3/t13-,15+,30?/m0/s1 |
| InChIKey | FNUBHUOIOUMLDC-JSAANWGUSA-N |
| XLogP | -0.01 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|