About methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene
methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene (PubChem CID 161375634) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene.
Molecular Properties
| Compound Name | methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene |
| PubChem CID | 161375634 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene |
| SMILES | COC(=O)NC(C=O)C1CCOCC1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H15NO4/c1-2-6-10-8-4-3-7-9(10)5-1;1-13-9(12)10-8(6-11)7-2-4-14-5-3-7/h1-8H;6-8H,2-5H2,1H3,(H,10,12) |
| InChIKey | VRASHHOPTRDJCW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene?
The IUPAC name of methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene (CID 161375634) is methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene.
What is the SMILES notation for methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene?
The canonical SMILES for methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene is COC(=O)NC(C=O)C1CCOCC1.c1ccc2ccccc2c1.
What is the InChIKey of methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene?
The InChIKey is VRASHHOPTRDJCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C9H15NO4/c1-2-6-10-8-4-3-7-9(10)5-1;1-13-9(12)10-8(6-11)7-2-4-14-5-3-7/h1-8H;6-8H,2-5H2,1H3,(H,10,12).
What are the key properties of methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene?
methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene has a molecular weight of 329.40 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(oxan-4-yl)-2-oxoethyl]carbamate;naphthalene is sourced from PubChem (CID 161375634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).