C23H22N2O9 — CID 161379320
ethyl 4-formyl-5-hydroxy-1H-indole-2-carboxylate;4-formyl-5-hydroxy-1H-indole-2-carboxylic acid;methanol (PubChem CID 161379320) has the molecular formula C23H22N2O9 and a molecular weight of 470.43 g/mol. Its IUPAC name is ethyl 4-formyl-5-hydroxy-1H-indole-2-carboxylate;4-formyl-5-hydroxy-1H-indole-2-carboxylic acid;methanol.
| Compound Name | ethyl 4-formyl-5-hydroxy-1H-indole-2-carboxylate;4-formyl-5-hydroxy-1H-indole-2-carboxylic acid;methanol |
|---|---|
| PubChem CID | 161379320 |
| Molecular Formula | C23H22N2O9 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | ethyl 4-formyl-5-hydroxy-1H-indole-2-carboxylate;4-formyl-5-hydroxy-1H-indole-2-carboxylic acid;methanol |
| SMILES | CCOC(=O)c1cc2c(C=O)c(O)ccc2[nH]1.CO.O=Cc1c(O)ccc2[nH]c(C(=O)O)cc12 |
| InChI | InChI=1S/C12H11NO4.C10H7NO4.CH4O/c1-2-17-12(16)10-5-7-8(6-14)11(15)4-3-9(7)13-10;12-4-6-5-3-8(10(14)15)11-7(5)1-2-9(6)13;1-2/h3-6,13,15H,2H2,1H3;1-4,11,13H,(H,14,15);2H,1H3 |
| InChIKey | VRMWMWNSBLWXOJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 190.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|