C20H25BrCl4O2 — CID 161381975
1-bromobutane;1-butoxy-2,4-dichlorobenzene;2,4-dichlorophenol (PubChem CID 161381975) has the molecular formula C20H25BrCl4O2 and a molecular weight of 519.13 g/mol. Its IUPAC name is 1-bromobutane;1-butoxy-2,4-dichlorobenzene;2,4-dichlorophenol.
| Compound Name | 1-bromobutane;1-butoxy-2,4-dichlorobenzene;2,4-dichlorophenol |
|---|---|
| PubChem CID | 161381975 |
| Molecular Formula | C20H25BrCl4O2 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 1-bromobutane;1-butoxy-2,4-dichlorobenzene;2,4-dichlorophenol |
| SMILES | CCCCBr.CCCCOc1ccc(Cl)cc1Cl.Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O.C6H4Cl2O.C4H9Br/c1-2-3-6-13-10-5-4-8(11)7-9(10)12;7-4-1-2-6(9)5(8)3-4;1-2-3-4-5/h4-5,7H,2-3,6H2,1H3;1-3,9H;2-4H2,1H3 |
| InChIKey | VRVJVKOMTFWWLS-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|