C23H26N4O4 — CID 161385598
(4aR,8aS)-6-[3-[4-(4-methylpyrimidin-2-yl)oxyphenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 161385598) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[4-(4-methylpyrimidin-2-yl)oxyphenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[4-(4-methylpyrimidin-2-yl)oxyphenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 161385598 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (4aR,8aS)-6-[3-[4-(4-methylpyrimidin-2-yl)oxyphenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | Cc1ccnc(Oc2ccc(C3CN(C(=O)N4CC[C@@H]5OCC(=O)C[C@@H]5C4)C3)cc2)n1 |
| InChI | InChI=1S/C23H26N4O4/c1-15-6-8-24-22(25-15)31-20-4-2-16(3-5-20)18-12-27(13-18)23(29)26-9-7-21-17(11-26)10-19(28)14-30-21/h2-6,8,17-18,21H,7,9-14H2,1H3/t17-,21+/m1/s1 |
| InChIKey | VSHLRDIHSUJJBM-UTKZUKDTSA-N |
| XLogP | 2.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |