C28H22O6 — CID 161386076
5-ethenyl-2-benzofuran-1,3-dione;6-ethenyl-3H-2-benzofuran-1-one;3-ethenylphenol (PubChem CID 161386076) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is 5-ethenyl-2-benzofuran-1,3-dione;6-ethenyl-3H-2-benzofuran-1-one;3-ethenylphenol.
| Compound Name | 5-ethenyl-2-benzofuran-1,3-dione;6-ethenyl-3H-2-benzofuran-1-one;3-ethenylphenol |
|---|---|
| PubChem CID | 161386076 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 5-ethenyl-2-benzofuran-1,3-dione;6-ethenyl-3H-2-benzofuran-1-one;3-ethenylphenol |
| SMILES | C=Cc1ccc2c(c1)C(=O)OC2.C=Cc1ccc2c(c1)C(=O)OC2=O.C=Cc1cccc(O)c1 |
| InChI | InChI=1S/C10H6O3.C10H8O2.C8H8O/c1-2-6-3-4-7-8(5-6)10(12)13-9(7)11;1-2-7-3-4-8-6-12-10(11)9(8)5-7;1-2-7-4-3-5-8(9)6-7/h2-5H,1H2;2-5H,1,6H2;2-6,9H,1H2 |
| InChIKey | VSJDEYUGCPNESN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|