C27H25N3O — CID 161388785
N-(2-aminophenyl)-4-[[1-(3H-inden-5-ylmethyl)azetidin-3-ylidene]methyl]benzamide (PubChem CID 161388785) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[1-(3H-inden-5-ylmethyl)azetidin-3-ylidene]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[1-(3H-inden-5-ylmethyl)azetidin-3-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 161388785 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[[1-(3H-inden-5-ylmethyl)azetidin-3-ylidene]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C=C2CN(Cc3ccc4c(c3)CC=C4)C2)cc1 |
| InChI | InChI=1S/C27H25N3O/c28-25-6-1-2-7-26(25)29-27(31)23-12-8-19(9-13-23)14-21-17-30(18-21)16-20-10-11-22-4-3-5-24(22)15-20/h1-4,6-15H,5,16-18,28H2,(H,29,31) |
| InChIKey | VSRWMBMNLIULQR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|