C34H42N8O2 — CID 161394962
N-(4-methyl-3-nitro-2-pyridinyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine;3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-amine (PubChem CID 161394962) has the molecular formula C34H42N8O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is N-(4-methyl-3-nitro-2-pyridinyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine;3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-amine.
| Compound Name | N-(4-methyl-3-nitro-2-pyridinyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine;3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 161394962 |
| Molecular Formula | C34H42N8O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | N-(4-methyl-3-nitro-2-pyridinyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine;3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-amine |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(N)cc12.Cc1ccnc(Nc2ccc3[nH]cc(CC4CCCN4C)c3c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N5O2.C14H19N3/c1-13-7-8-21-20(19(13)25(26)27)23-15-5-6-18-17(11-15)14(12-22-18)10-16-4-3-9-24(16)2;1-17-6-2-3-12(17)7-10-9-16-14-5-4-11(15)8-13(10)14/h5-8,11-12,16,22H,3-4,9-10H2,1-2H3,(H,21,23);4-5,8-9,12,16H,2-3,6-7,15H2,1H3/t;12-/m.1/s1 |
| InChIKey | VTMBMIHLEXQMNE-MBBUEALLSA-N |
| XLogP | 6.55 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|