C20H21ClN4O2 — CID 70207456
N-(4-chloro-2-nitrophenyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine (PubChem CID 70207456) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine.
| Compound Name | N-(4-chloro-2-nitrophenyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 70207456 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-amine |
| SMILES | CN1CCCC1Cc1c[nH]c2ccc(Nc3ccc(Cl)cc3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H21ClN4O2/c1-24-8-2-3-16(24)9-13-12-22-18-7-5-15(11-17(13)18)23-19-6-4-14(21)10-20(19)25(26)27/h4-7,10-12,16,22-23H,2-3,8-9H2,1H3 |
| InChIKey | VUBDPXCDXHSTJB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|