C21H21F3N4O2 — CID 54472892
3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indol-5-amine (PubChem CID 54472892) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indol-5-amine.
| Compound Name | 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 54472892 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-[2-nitro-4-(trifluoromethyl)phenyl]-1H-indol-5-amine |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H21F3N4O2/c1-27-8-2-3-16(27)9-13-12-25-18-7-5-15(11-17(13)18)26-19-6-4-14(21(22,23)24)10-20(19)28(29)30/h4-7,10-12,16,25-26H,2-3,8-9H2,1H3/t16-/m1/s1 |
| InChIKey | XJNSAOAOIJNZNJ-MRXNPFEDSA-N |
| XLogP | 5.48 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|