C20H22ClN3 — CID 171706539
5-chloro-2-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]aniline (PubChem CID 171706539) has the molecular formula C20H22ClN3 and a molecular weight of 339.87 g/mol. Its IUPAC name is 5-chloro-2-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]aniline.
| Compound Name | 5-chloro-2-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]aniline |
|---|---|
| PubChem CID | 171706539 |
| Molecular Formula | C20H22ClN3 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-chloro-2-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]aniline |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(-c3ccc(Cl)cc3N)cc12 |
| InChI | InChI=1S/C20H22ClN3/c1-24-8-2-3-16(24)9-14-12-23-20-7-4-13(10-18(14)20)17-6-5-15(21)11-19(17)22/h4-7,10-12,16,23H,2-3,8-9,22H2,1H3/t16-/m1/s1 |
| InChIKey | LBCLTNPXHUIPBF-MRXNPFEDSA-N |
| XLogP | 4.71 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|