C23H27N5O3 — CID 19040773
2-[2-[[5-[(3-nitro-2-pyridinyl)amino]-1H-indol-3-yl]methyl]pyrrolidin-1-yl]cyclopentan-1-ol (PubChem CID 19040773) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[2-[[5-[(3-nitro-2-pyridinyl)amino]-1H-indol-3-yl]methyl]pyrrolidin-1-yl]cyclopentan-1-ol.
| Compound Name | 2-[2-[[5-[(3-nitro-2-pyridinyl)amino]-1H-indol-3-yl]methyl]pyrrolidin-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 19040773 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[2-[[5-[(3-nitro-2-pyridinyl)amino]-1H-indol-3-yl]methyl]pyrrolidin-1-yl]cyclopentan-1-ol |
| SMILES | O=[N+]([O-])c1cccnc1Nc1ccc2[nH]cc(CC3CCCN3C3CCCC3O)c2c1 |
| InChI | InChI=1S/C23H27N5O3/c29-22-7-1-5-20(22)27-11-3-4-17(27)12-15-14-25-19-9-8-16(13-18(15)19)26-23-21(28(30)31)6-2-10-24-23/h2,6,8-10,13-14,17,20,22,25,29H,1,3-5,7,11-12H2,(H,24,26) |
| InChIKey | GBZMIEDXOMEWAK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|