C32H21F8NOS — CID 161400094
carbonyl difluoride;4-fluoro-N-[(1R)-1-(4-fluorophenyl)-1-(3-fluoro-5-prop-2-ynylphenyl)-2-phenylethyl]-3-(trifluoromethyl)benzenecarbothioamide (PubChem CID 161400094) has the molecular formula C32H21F8NOS and a molecular weight of 619.58 g/mol. Its IUPAC name is carbonyl difluoride;4-fluoro-N-[(1R)-1-(4-fluorophenyl)-1-(3-fluoro-5-prop-2-ynylphenyl)-2-phenylethyl]-3-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | carbonyl difluoride;4-fluoro-N-[(1R)-1-(4-fluorophenyl)-1-(3-fluoro-5-prop-2-ynylphenyl)-2-phenylethyl]-3-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 161400094 |
| Molecular Formula | C32H21F8NOS |
| Molecular Weight | 619.58 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | carbonyl difluoride;4-fluoro-N-[(1R)-1-(4-fluorophenyl)-1-(3-fluoro-5-prop-2-ynylphenyl)-2-phenylethyl]-3-(trifluoromethyl)benzenecarbothioamide |
| SMILES | C#CCc1cc(F)cc([C@](Cc2ccccc2)(NC(=S)c2ccc(F)c(C(F)(F)F)c2)c2ccc(F)cc2)c1.O=C(F)F |
| InChI | InChI=1S/C31H21F6NS.CF2O/c1-2-6-21-15-24(18-26(33)16-21)30(19-20-7-4-3-5-8-20,23-10-12-25(32)13-11-23)38-29(39)22-9-14-28(34)27(17-22)31(35,36)37;2-1(3)4/h1,3-5,7-18H,6,19H2,(H,38,39);/t30-;/m1./s1 |
| InChIKey | VUCVVRVMEGCEFT-VNUFCWELSA-N |
| XLogP | 8.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.58 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|