C27H22F6N2O — CID 58897863
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-phenylethyl]-3-prop-2-ynylurea (PubChem CID 58897863) has the molecular formula C27H22F6N2O and a molecular weight of 504.47 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-phenylethyl]-3-prop-2-ynylurea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-phenylethyl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 58897863 |
| Molecular Formula | C27H22F6N2O |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-2-phenylethyl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(CC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H22F6N2O/c1-2-12-34-25(36)35-26(16-18-6-4-3-5-7-18,20-8-10-22(28)11-9-20)21-13-19(14-23(29)15-21)17-27(32,33)24(30)31/h1,3-11,13-15,24H,12,16-17H2,(H2,34,35,36)/t26-/m1/s1 |
| InChIKey | VEGDGHVVIFMECF-AREMUKBSSA-N |
| XLogP | 5.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|