C15H18F3NO — CID 161422915
3-methoxy-N-(2-methylbut-3-yn-2-yl)-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 161422915) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-methoxy-N-(2-methylbut-3-yn-2-yl)-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 3-methoxy-N-(2-methylbut-3-yn-2-yl)-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 161422915 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-methoxy-N-(2-methylbut-3-yn-2-yl)-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | C#CC(C)(C)N(CCC(F)(F)F)c1cccc(OC)c1 |
| InChI | InChI=1S/C15H18F3NO/c1-5-14(2,3)19(10-9-15(16,17)18)12-7-6-8-13(11-12)20-4/h1,6-8,11H,9-10H2,2-4H3 |
| InChIKey | USPICTGQUPVMRY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|