C34H39N7O4 — CID 161426042
ethane;1-[4-[4-[4-[[2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-4H-imidazol-5-one (PubChem CID 161426042) has the molecular formula C34H39N7O4 and a molecular weight of 609.73 g/mol. Its IUPAC name is ethane;1-[4-[4-[4-[[2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-4H-imidazol-5-one.
| Compound Name | ethane;1-[4-[4-[4-[[2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-4H-imidazol-5-one |
|---|---|
| PubChem CID | 161426042 |
| Molecular Formula | C34H39N7O4 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | ethane;1-[4-[4-[4-[[2-phenyl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-4H-imidazol-5-one |
| SMILES | CC.O=C1CN=CN1c1ccc(N2CCN(c3ccc(OCC4COC(Cn5cncn5)(c5ccccc5)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H33N7O4.C2H6/c40-31-18-33-24-39(31)28-8-6-26(7-9-28)36-14-16-37(17-15-36)27-10-12-29(13-11-27)41-19-30-20-42-32(43-30,21-38-23-34-22-35-38)25-4-2-1-3-5-25;1-2/h1-13,22-24,30H,14-21H2;1-2H3 |
| InChIKey | VXJHHXVRZYXYSF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|