C16H19F3N4O2 — CID 161428212
N-methyl-4-[4-(oxan-2-yloxymethyl)triazol-1-yl]-2-(trifluoromethyl)aniline (PubChem CID 161428212) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-methyl-4-[4-(oxan-2-yloxymethyl)triazol-1-yl]-2-(trifluoromethyl)aniline.
| Compound Name | N-methyl-4-[4-(oxan-2-yloxymethyl)triazol-1-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 161428212 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-methyl-4-[4-(oxan-2-yloxymethyl)triazol-1-yl]-2-(trifluoromethyl)aniline |
| SMILES | CNc1ccc(-n2cc(COC3CCCCO3)nn2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O2/c1-20-14-6-5-12(8-13(14)16(17,18)19)23-9-11(21-22-23)10-25-15-4-2-3-7-24-15/h5-6,8-9,15,20H,2-4,7,10H2,1H3 |
| InChIKey | VXQSDHVBHMKILS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |