C16H23N5O2 — CID 153349674
1-methyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine (PubChem CID 153349674) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-methyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine.
| Compound Name | 1-methyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 153349674 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-methyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine |
| SMILES | CNNCc1ccc(-n2cc(COC3CCCCO3)nn2)cc1 |
| InChI | InChI=1S/C16H23N5O2/c1-17-18-10-13-5-7-15(8-6-13)21-11-14(19-20-21)12-23-16-4-2-3-9-22-16/h5-8,11,16-18H,2-4,9-10,12H2,1H3 |
| InChIKey | RMHQISORIYVBOG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|