C18H27N3O2 — CID 145305024
ethane;1-(4-ethylphenyl)-5-(oxan-2-yloxymethyl)triazole (PubChem CID 145305024) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is ethane;1-(4-ethylphenyl)-5-(oxan-2-yloxymethyl)triazole.
| Compound Name | ethane;1-(4-ethylphenyl)-5-(oxan-2-yloxymethyl)triazole |
|---|---|
| PubChem CID | 145305024 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | ethane;1-(4-ethylphenyl)-5-(oxan-2-yloxymethyl)triazole |
| SMILES | CC.CCc1ccc(-n2nncc2COC2CCCCO2)cc1 |
| InChI | InChI=1S/C16H21N3O2.C2H6/c1-2-13-6-8-14(9-7-13)19-15(11-17-18-19)12-21-16-5-3-4-10-20-16;1-2/h6-9,11,16H,2-5,10,12H2,1H3;1-2H3 |
| InChIKey | TWIPGIQHDXIUTF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |