About 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane
2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane (PubChem CID 161433654) has the molecular formula C15H36N2O4
and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane.
Molecular Properties
| Compound Name | 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane |
| PubChem CID | 161433654 |
| Molecular Formula | C15H36N2O4 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane |
| SMILES | C.CCCCCC(OCC(C)(N)CO)OCC(C)(N)CO |
| InChI | InChI=1S/C14H32N2O4.CH4/c1-4-5-6-7-12(19-10-13(2,15)8-17)20-11-14(3,16)9-18;/h12,17-18H,4-11,15-16H2,1-3H3;1H4 |
| InChIKey | VYIUIDYJUHISSP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane?
The IUPAC name of 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane (CID 161433654) is 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane.
What is the SMILES notation for 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane?
The canonical SMILES for 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane is C.CCCCCC(OCC(C)(N)CO)OCC(C)(N)CO.
What is the InChIKey of 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane?
The InChIKey is VYIUIDYJUHISSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2O4.CH4/c1-4-5-6-7-12(19-10-13(2,15)8-17)20-11-14(3,16)9-18;/h12,17-18H,4-11,15-16H2,1-3H3;1H4.
What are the key properties of 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane?
2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane has a molecular weight of 308.46 g/mol, XLogP of 0.98, 12 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[1-(2-amino-3-hydroxy-2-methylpropoxy)hexoxy]-2-methylpropan-1-ol;methane is sourced from PubChem (CID 161433654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).