C17H18O3 — CID 161433806
1-ethenyl-4-ethylbenzene;(2-hydroxyphenyl) formate (PubChem CID 161433806) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-ethenyl-4-ethylbenzene;(2-hydroxyphenyl) formate.
| Compound Name | 1-ethenyl-4-ethylbenzene;(2-hydroxyphenyl) formate |
|---|---|
| PubChem CID | 161433806 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-ethenyl-4-ethylbenzene;(2-hydroxyphenyl) formate |
| SMILES | C=Cc1ccc(CC)cc1.O=COc1ccccc1O |
| InChI | InChI=1S/C10H12.C7H6O3/c1-3-9-5-7-10(4-2)8-6-9;8-5-10-7-4-2-1-3-6(7)9/h3,5-8H,1,4H2,2H3;1-5,9H |
| InChIKey | VYJILCKVOORVPX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|