C24H26N10O5 — CID 161434218
ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;methane;5-[(7H-purin-6-ylamino)methyl]furan-2-ol (PubChem CID 161434218) has the molecular formula C24H26N10O5 and a molecular weight of 534.54 g/mol. Its IUPAC name is ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;methane;5-[(7H-purin-6-ylamino)methyl]furan-2-ol.
| Compound Name | ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;methane;5-[(7H-purin-6-ylamino)methyl]furan-2-ol |
|---|---|
| PubChem CID | 161434218 |
| Molecular Formula | C24H26N10O5 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;methane;5-[(7H-purin-6-ylamino)methyl]furan-2-ol |
| SMILES | C.CCOC(=O)c1ccc(CNc2ncnc3nc[nH]c23)o1.Oc1ccc(CNc2ncnc3nc[nH]c23)o1 |
| InChI | InChI=1S/C13H13N5O3.C10H9N5O2.CH4/c1-2-20-13(19)9-4-3-8(21-9)5-14-11-10-12(16-6-15-10)18-7-17-11;16-7-2-1-6(17-7)3-11-9-8-10(13-4-12-8)15-5-14-9;/h3-4,6-7H,2,5H2,1H3,(H2,14,15,16,17,18);1-2,4-5,16H,3H2,(H2,11,12,13,14,15);1H4 |
| InChIKey | VYKSEWLYWHDAMN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 205.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |