About carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate
carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate (PubChem CID 161459706) has the molecular formula C7H16O7S
and a molecular weight of 244.26 g/mol. Its IUPAC name is carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate.
Molecular Properties
| Compound Name | carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate |
| PubChem CID | 161459706 |
| Molecular Formula | C7H16O7S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate |
| SMILES | COCOCC(CO[O-])S(=O)(=O)[O-].[CH3+].[CH3+] |
| InChI | InChI=1S/C5H12O7S.2CH3/c1-10-4-11-2-5(3-12-6)13(7,8)9;;/h5-6H,2-4H2,1H3,(H,7,8,9);2*1H3/q;2*+1/p-2 |
| InChIKey | WBQBKKZCYYCPBC-UHFFFAOYSA-L |
| XLogP | -1.29 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate?
The IUPAC name of carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate (CID 161459706) is carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate.
What is the SMILES notation for carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate?
The canonical SMILES for carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate is COCOCC(CO[O-])S(=O)(=O)[O-].[CH3+].[CH3+].
What is the InChIKey of carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate?
The InChIKey is WBQBKKZCYYCPBC-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H12O7S.2CH3/c1-10-4-11-2-5(3-12-6)13(7,8)9;;/h5-6H,2-4H2,1H3,(H,7,8,9);2*1H3/q;2*+1/p-2.
What are the key properties of carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate?
carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate has a molecular weight of 244.26 g/mol, XLogP of -1.29, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;1-(methoxymethoxy)-3-oxidooxypropane-2-sulfonate is sourced from PubChem (CID 161459706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).