C12H18N5O+ — CID 161461213
1-[(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)oxy]benzotriazole;methane (PubChem CID 161461213) has the molecular formula C12H18N5O+ and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-[(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)oxy]benzotriazole;methane.
| Compound Name | 1-[(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)oxy]benzotriazole;methane |
|---|---|
| PubChem CID | 161461213 |
| Molecular Formula | C12H18N5O+ |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-[(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)oxy]benzotriazole;methane |
| SMILES | C.CN1CC[N+](C)=C1On1nnc2ccccc21 |
| InChI | InChI=1S/C11H14N5O.CH4/c1-14-7-8-15(2)11(14)17-16-10-6-4-3-5-9(10)12-13-16;/h3-6H,7-8H2,1-2H3;1H4/q+1; |
| InChIKey | WBVJZLPBXZIOKW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|