C12H16N5O+ — CID 118194087
1-[(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)oxy]benzotriazole (PubChem CID 118194087) has the molecular formula C12H16N5O+ and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-[(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)oxy]benzotriazole.
| Compound Name | 1-[(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)oxy]benzotriazole |
|---|---|
| PubChem CID | 118194087 |
| Molecular Formula | C12H16N5O+ |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-[(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)oxy]benzotriazole |
| SMILES | CN1CCC[N+](C)=C1On1nnc2ccccc21 |
| InChI | InChI=1S/C12H16N5O/c1-15-8-5-9-16(2)12(15)18-17-11-7-4-3-6-10(11)13-14-17/h3-4,6-7H,5,8-9H2,1-2H3/q+1 |
| InChIKey | BDGHKIMUAWRHRC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|