C33H42N2 — CID 161465189
5-N,6-N-bis(3-pent-1-ynylphenyl)undecane-5,6-diimine (PubChem CID 161465189) has the molecular formula C33H42N2 and a molecular weight of 466.71 g/mol. Its IUPAC name is 5-N,6-N-bis(3-pent-1-ynylphenyl)undecane-5,6-diimine.
| Compound Name | 5-N,6-N-bis(3-pent-1-ynylphenyl)undecane-5,6-diimine |
|---|---|
| PubChem CID | 161465189 |
| Molecular Formula | C33H42N2 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 5-N,6-N-bis(3-pent-1-ynylphenyl)undecane-5,6-diimine |
| SMILES | CCCC#Cc1cccc(/N=C(CCCC)/C(CCCCC)=N/c2cccc(C#CCCC)c2)c1 |
| InChI | InChI=1S/C33H42N2/c1-5-9-13-18-28-20-16-22-30(26-28)34-32(24-12-8-4)33(25-15-11-7-3)35-31-23-17-21-29(27-31)19-14-10-6-2/h16-17,20-23,26-27H,5-12,15,24-25H2,1-4H3/b34-32+,35-33+ |
| InChIKey | SVAOVBINLVMKMM-XUXOKTBYSA-N |
| XLogP | 9.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|